C29H43ClN4O7S2 — CID 159254418
benzyl (2S)-3-[4-(5-azidopentoxy)phenyl]-2-(butylsulfonylamino)propanoate;butane-1-sulfonyl chloride (PubChem CID 159254418) has the molecular formula C29H43ClN4O7S2 and a molecular weight of 659.27 g/mol. Its IUPAC name is benzyl (2S)-3-[4-(5-azidopentoxy)phenyl]-2-(butylsulfonylamino)propanoate;butane-1-sulfonyl chloride.
| Compound Name | benzyl (2S)-3-[4-(5-azidopentoxy)phenyl]-2-(butylsulfonylamino)propanoate;butane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 159254418 |
| Molecular Formula | C29H43ClN4O7S2 |
| Molecular Weight | 659.27 g/mol |
| Exact Mass | 658.23 |
| IUPAC Name | benzyl (2S)-3-[4-(5-azidopentoxy)phenyl]-2-(butylsulfonylamino)propanoate;butane-1-sulfonyl chloride |
| SMILES | CCCCS(=O)(=O)Cl.CCCCS(=O)(=O)N[C@@H](Cc1ccc(OCCCCCN=[N+]=[N-])cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H34N4O5S.C4H9ClO2S/c1-2-3-18-35(31,32)28-24(25(30)34-20-22-10-6-4-7-11-22)19-21-12-14-23(15-13-21)33-17-9-5-8-16-27-29-26;1-2-3-4-8(5,6)7/h4,6-7,10-15,24,28H,2-3,5,8-9,16-20H2,1H3;2-4H2,1H3/t24-;/m0./s1 |
| InChIKey | KVSAEAJVHVJLMA-JIDHJSLPSA-N |
| XLogP | 6.28 |
| TPSA | 164.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.27 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|