C14H20ClNO4S — CID 116815015
methyl 2-(4-chlorobutylsulfonylamino)-3-phenylpropanoate (PubChem CID 116815015) has the molecular formula C14H20ClNO4S and a molecular weight of 333.84 g/mol. Its IUPAC name is methyl 2-(4-chlorobutylsulfonylamino)-3-phenylpropanoate.
| Compound Name | methyl 2-(4-chlorobutylsulfonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 116815015 |
| Molecular Formula | C14H20ClNO4S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | methyl 2-(4-chlorobutylsulfonylamino)-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NS(=O)(=O)CCCCCl |
| InChI | InChI=1S/C14H20ClNO4S/c1-20-14(17)13(11-12-7-3-2-4-8-12)16-21(18,19)10-6-5-9-15/h2-4,7-8,13,16H,5-6,9-11H2,1H3 |
| InChIKey | TUAASEXYJZXIEW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|