C11H14ClNO4S — CID 174358903
chloromethyl (2S)-2-(methanesulfonamido)-3-phenylpropanoate (PubChem CID 174358903) has the molecular formula C11H14ClNO4S and a molecular weight of 291.76 g/mol. Its IUPAC name is chloromethyl (2S)-2-(methanesulfonamido)-3-phenylpropanoate.
| Compound Name | chloromethyl (2S)-2-(methanesulfonamido)-3-phenylpropanoate |
|---|---|
| PubChem CID | 174358903 |
| Molecular Formula | C11H14ClNO4S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | chloromethyl (2S)-2-(methanesulfonamido)-3-phenylpropanoate |
| SMILES | CS(=O)(=O)N[C@@H](Cc1ccccc1)C(=O)OCCl |
| InChI | InChI=1S/C11H14ClNO4S/c1-18(15,16)13-10(11(14)17-8-12)7-9-5-3-2-4-6-9/h2-6,10,13H,7-8H2,1H3/t10-/m0/s1 |
| InChIKey | OHVLJBIZNVLHNI-JTQLQIEISA-N |
| XLogP | 0.89 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|