About bis(chloromethyl (2S)-2-(4-methylanilino)-3-phenylpropanoate);formaldehyde
bis(chloromethyl (2S)-2-(4-methylanilino)-3-phenylpropanoate);formaldehyde (PubChem CID 139503130) has the molecular formula C35H38Cl2N2O5
and a molecular weight of 637.60 g/mol. Its IUPAC name is bis(chloromethyl (2S)-2-(4-methylanilino)-3-phenylpropanoate);formaldehyde.
Molecular Properties
| Compound Name | bis(chloromethyl (2S)-2-(4-methylanilino)-3-phenylpropanoate);formaldehyde |
| PubChem CID | 139503130 |
| Molecular Formula | C35H38Cl2N2O5 |
| Molecular Weight | 637.60 g/mol |
| Exact Mass | 636.22 |
| IUPAC Name | bis(chloromethyl (2S)-2-(4-methylanilino)-3-phenylpropanoate);formaldehyde |
| SMILES | C=O.Cc1ccc(N[C@@H](Cc2ccccc2)C(=O)OCCl)cc1.Cc1ccc(N[C@@H](Cc2ccccc2)C(=O)OCCl)cc1 |
| InChI | InChI=1S/2C17H18ClNO2.CH2O/c2*1-13-7-9-15(10-8-13)19-16(17(20)21-12-18)11-14-5-3-2-4-6-14;1-2/h2*2-10,16,19H,11-12H2,1H3;1H2/t2*16-;/m00./s1 |
| InChIKey | YCDMVEPULCSUJM-WUBQCMAVSA-N |
| XLogP | 7.33 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 637.60 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bis(chloromethyl (2S)-2-(4-methylanilino)-3-phenylpropanoate);formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(chloromethyl (2S)-2-(4-methylanilino)-3-phenylpropanoate);formaldehyde?
The IUPAC name of bis(chloromethyl (2S)-2-(4-methylanilino)-3-phenylpropanoate);formaldehyde (CID 139503130) is bis(chloromethyl (2S)-2-(4-methylanilino)-3-phenylpropanoate);formaldehyde.
What is the SMILES notation for bis(chloromethyl (2S)-2-(4-methylanilino)-3-phenylpropanoate);formaldehyde?
The canonical SMILES for bis(chloromethyl (2S)-2-(4-methylanilino)-3-phenylpropanoate);formaldehyde is C=O.Cc1ccc(N[C@@H](Cc2ccccc2)C(=O)OCCl)cc1.Cc1ccc(N[C@@H](Cc2ccccc2)C(=O)OCCl)cc1.
What is the InChIKey of bis(chloromethyl (2S)-2-(4-methylanilino)-3-phenylpropanoate);formaldehyde?
The InChIKey is YCDMVEPULCSUJM-WUBQCMAVSA-N. The full InChI is InChI=1S/2C17H18ClNO2.CH2O/c2*1-13-7-9-15(10-8-13)19-16(17(20)21-12-18)11-14-5-3-2-4-6-14;1-2/h2*2-10,16,19H,11-12H2,1H3;1H2/t2*16-;/m00./s1.
What are the key properties of bis(chloromethyl (2S)-2-(4-methylanilino)-3-phenylpropanoate);formaldehyde?
bis(chloromethyl (2S)-2-(4-methylanilino)-3-phenylpropanoate);formaldehyde has a molecular weight of 637.60 g/mol, XLogP of 7.33, 12 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(chloromethyl (2S)-2-(4-methylanilino)-3-phenylpropanoate);formaldehyde is sourced from PubChem (CID 139503130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).