C11H16NO3PS — CID 11778055
methyl (2S)-2-[[hydroxy(methyl)phosphinothioyl]amino]-3-phenylpropanoate (PubChem CID 11778055) has the molecular formula C11H16NO3PS and a molecular weight of 273.29 g/mol. Its IUPAC name is methyl (2S)-2-[[hydroxy(methyl)phosphinothioyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[hydroxy(methyl)phosphinothioyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 11778055 |
| Molecular Formula | C11H16NO3PS |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | methyl (2S)-2-[[hydroxy(methyl)phosphinothioyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NP(C)(O)=S |
| InChI | InChI=1S/C11H16NO3PS/c1-15-11(13)10(12-16(2,14)17)8-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3,(H2,12,14,17)/t10-,16?/m0/s1 |
| InChIKey | AFWXNQHVOIGQLQ-VQVVDHBBSA-N |
| XLogP | 1.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|