C10H12NO3P — CID 174369868
methyl (2S)-3-phenyl-2-(phosphorosoamino)propanoate (PubChem CID 174369868) has the molecular formula C10H12NO3P and a molecular weight of 225.18 g/mol. Its IUPAC name is methyl (2S)-3-phenyl-2-(phosphorosoamino)propanoate.
| Compound Name | methyl (2S)-3-phenyl-2-(phosphorosoamino)propanoate |
|---|---|
| PubChem CID | 174369868 |
| Molecular Formula | C10H12NO3P |
| Molecular Weight | 225.18 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | methyl (2S)-3-phenyl-2-(phosphorosoamino)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NP=O |
| InChI | InChI=1S/C10H12NO3P/c1-14-10(12)9(11-15-13)7-8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H,11,13)/t9-/m0/s1 |
| InChIKey | KMJVUZUGZAYSPG-VIFPVBQESA-N |
| XLogP | 1.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|