C19H19F6NO7S — CID 159507354
methyl (2S)-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]-3-phenylpropanoate;sulfuric acid (PubChem CID 159507354) has the molecular formula C19H19F6NO7S and a molecular weight of 519.42 g/mol. Its IUPAC name is methyl (2S)-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]-3-phenylpropanoate;sulfuric acid.
| Compound Name | methyl (2S)-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]-3-phenylpropanoate;sulfuric acid |
|---|---|
| PubChem CID | 159507354 |
| Molecular Formula | C19H19F6NO7S |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 519.08 |
| IUPAC Name | methyl (2S)-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]-3-phenylpropanoate;sulfuric acid |
| SMILES | COC(=O)[C@H](Cc1ccccc1)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C19H17F6NO3.H2O4S/c1-29-16(27)15(11-12-5-3-2-4-6-12)26-14-9-7-13(8-10-14)17(28,18(20,21)22)19(23,24)25;1-5(2,3)4/h2-10,15,26,28H,11H2,1H3;(H2,1,2,3,4)/t15-;/m0./s1 |
| InChIKey | MADZAXKRIVDRRU-RSAXXLAASA-N |
| XLogP | 3.54 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|