C29H28N2O2 — CID 142662047
methyl (2S)-3-phenyl-2-(2-tritylhydrazinyl)propanoate (PubChem CID 142662047) has the molecular formula C29H28N2O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is methyl (2S)-3-phenyl-2-(2-tritylhydrazinyl)propanoate.
| Compound Name | methyl (2S)-3-phenyl-2-(2-tritylhydrazinyl)propanoate |
|---|---|
| PubChem CID | 142662047 |
| Molecular Formula | C29H28N2O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | methyl (2S)-3-phenyl-2-(2-tritylhydrazinyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NNC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H28N2O2/c1-33-28(32)27(22-23-14-6-2-7-15-23)30-31-29(24-16-8-3-9-17-24,25-18-10-4-11-19-25)26-20-12-5-13-21-26/h2-21,27,30-31H,22H2,1H3/t27-/m0/s1 |
| InChIKey | MVLNJQWUOBUYPV-MHZLTWQESA-N |
| XLogP | 4.86 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|