C30H27NO4 — CID 44563450
methyl (2R)-2-[[2-(4-hydroxyphenyl)-2,2-diphenylacetyl]amino]-3-phenylpropanoate (PubChem CID 44563450) has the molecular formula C30H27NO4 and a molecular weight of 465.55 g/mol. Its IUPAC name is methyl (2R)-2-[[2-(4-hydroxyphenyl)-2,2-diphenylacetyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-[[2-(4-hydroxyphenyl)-2,2-diphenylacetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 44563450 |
| Molecular Formula | C30H27NO4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | methyl (2R)-2-[[2-(4-hydroxyphenyl)-2,2-diphenylacetyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)NC(=O)C(c1ccccc1)(c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C30H27NO4/c1-35-28(33)27(21-22-11-5-2-6-12-22)31-29(34)30(23-13-7-3-8-14-23,24-15-9-4-10-16-24)25-17-19-26(32)20-18-25/h2-20,27,32H,21H2,1H3,(H,31,34)/t27-/m1/s1 |
| InChIKey | XZMLYFUVHNGFOQ-HHHXNRCGSA-N |
| XLogP | 4.63 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|