C36H33NO3 — CID 101405687
methyl (2S)-3-[4-(4-methylphenoxy)phenyl]-2-(tritylamino)propanoate (PubChem CID 101405687) has the molecular formula C36H33NO3 and a molecular weight of 527.66 g/mol. Its IUPAC name is methyl (2S)-3-[4-(4-methylphenoxy)phenyl]-2-(tritylamino)propanoate.
| Compound Name | methyl (2S)-3-[4-(4-methylphenoxy)phenyl]-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 101405687 |
| Molecular Formula | C36H33NO3 |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | methyl (2S)-3-[4-(4-methylphenoxy)phenyl]-2-(tritylamino)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(Oc2ccc(C)cc2)cc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H33NO3/c1-27-18-22-32(23-19-27)40-33-24-20-28(21-25-33)26-34(35(38)39-2)37-36(29-12-6-3-7-13-29,30-14-8-4-9-15-30)31-16-10-5-11-17-31/h3-25,34,37H,26H2,1-2H3/t34-/m0/s1 |
| InChIKey | FVMURNRNSWMFAS-UMSFTDKQSA-N |
| XLogP | 7.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|