C41H43NO6S — CID 124597074
tert-butyl (2R)-3-[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]-2-(tritylamino)propanoate (PubChem CID 124597074) has the molecular formula C41H43NO6S and a molecular weight of 677.86 g/mol. Its IUPAC name is tert-butyl (2R)-3-[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]-2-(tritylamino)propanoate.
| Compound Name | tert-butyl (2R)-3-[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 124597074 |
| Molecular Formula | C41H43NO6S |
| Molecular Weight | 677.86 g/mol |
| Exact Mass | 677.28 |
| IUPAC Name | tert-butyl (2R)-3-[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]-2-(tritylamino)propanoate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2ccc(C[C@@H](NC(c3ccccc3)(c3ccccc3)c3ccccc3)C(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C41H43NO6S/c1-31-20-26-37(27-21-31)49(44,45)47-29-28-46-36-24-22-32(23-25-36)30-38(39(43)48-40(2,3)4)42-41(33-14-8-5-9-15-33,34-16-10-6-11-17-34)35-18-12-7-13-19-35/h5-27,38,42H,28-30H2,1-4H3/t38-/m1/s1 |
| InChIKey | KSGPTMKBCVMBBB-KXQOOQHDSA-N |
| XLogP | 7.61 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.86 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|