C16H25NO6S — CID 139746847
tert-butyl 3-amino-2-[2-(4-methylphenyl)sulfonyloxyethoxy]propanoate (PubChem CID 139746847) has the molecular formula C16H25NO6S and a molecular weight of 359.44 g/mol. Its IUPAC name is tert-butyl 3-amino-2-[2-(4-methylphenyl)sulfonyloxyethoxy]propanoate.
| Compound Name | tert-butyl 3-amino-2-[2-(4-methylphenyl)sulfonyloxyethoxy]propanoate |
|---|---|
| PubChem CID | 139746847 |
| Molecular Formula | C16H25NO6S |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | tert-butyl 3-amino-2-[2-(4-methylphenyl)sulfonyloxyethoxy]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOC(CN)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H25NO6S/c1-12-5-7-13(8-6-12)24(19,20)22-10-9-21-14(11-17)15(18)23-16(2,3)4/h5-8,14H,9-11,17H2,1-4H3 |
| InChIKey | FIXHDKJCPXEULH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|