C18H26O6S — CID 134129818
tert-butyl 3-[2-(4-methylphenyl)sulfonyloxyethoxy]cyclobutane-1-carboxylate (PubChem CID 134129818) has the molecular formula C18H26O6S and a molecular weight of 370.47 g/mol. Its IUPAC name is tert-butyl 3-[2-(4-methylphenyl)sulfonyloxyethoxy]cyclobutane-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(4-methylphenyl)sulfonyloxyethoxy]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 134129818 |
| Molecular Formula | C18H26O6S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | tert-butyl 3-[2-(4-methylphenyl)sulfonyloxyethoxy]cyclobutane-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOC2CC(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C18H26O6S/c1-13-5-7-16(8-6-13)25(20,21)23-10-9-22-15-11-14(12-15)17(19)24-18(2,3)4/h5-8,14-15H,9-12H2,1-4H3 |
| InChIKey | WEZPGVBMQJKKIA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|