C19H29NO7S — CID 170595001
tert-butyl (2S,4R)-2-(hydroxymethyl)-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate (PubChem CID 170595001) has the molecular formula C19H29NO7S and a molecular weight of 415.51 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-(hydroxymethyl)-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-(hydroxymethyl)-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 170595001 |
| Molecular Formula | C19H29NO7S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | tert-butyl (2S,4R)-2-(hydroxymethyl)-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCCO[C@@H]2C[C@@H](CO)N(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C19H29NO7S/c1-14-5-7-17(8-6-14)28(23,24)26-10-9-25-16-11-15(13-21)20(12-16)18(22)27-19(2,3)4/h5-8,15-16,21H,9-13H2,1-4H3/t15-,16+/m0/s1 |
| InChIKey | PCRIFXKRNSDUDK-JKSUJKDBSA-N |
| XLogP | 2.09 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|