C17H25NO5S — CID 59898021
tert-butyl (2S,4S)-2-methyl-4-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate (PubChem CID 59898021) has the molecular formula C17H25NO5S and a molecular weight of 355.46 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-methyl-4-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-methyl-4-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59898021 |
| Molecular Formula | C17H25NO5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | tert-butyl (2S,4S)-2-methyl-4-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2C[C@H](C)N(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C17H25NO5S/c1-12-6-8-15(9-7-12)24(20,21)23-14-10-13(2)18(11-14)16(19)22-17(3,4)5/h6-9,13-14H,10-11H2,1-5H3/t13-,14-/m0/s1 |
| InChIKey | YLEPSRZQRCCMAD-KBPBESRZSA-N |
| XLogP | 3.10 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|