C13H15NO7S — CID 57088138
(2R,4S)-4-(4-methylphenyl)sulfonyloxypyrrolidine-1,2-dicarboxylic acid (PubChem CID 57088138) has the molecular formula C13H15NO7S and a molecular weight of 329.33 g/mol. Its IUPAC name is (2R,4S)-4-(4-methylphenyl)sulfonyloxypyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2R,4S)-4-(4-methylphenyl)sulfonyloxypyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 57088138 |
| Molecular Formula | C13H15NO7S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | (2R,4S)-4-(4-methylphenyl)sulfonyloxypyrrolidine-1,2-dicarboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2C[C@H](C(=O)O)N(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C13H15NO7S/c1-8-2-4-10(5-3-8)22(19,20)21-9-6-11(12(15)16)14(7-9)13(17)18/h2-5,9,11H,6-7H2,1H3,(H,15,16)(H,17,18)/t9-,11+/m0/s1 |
| InChIKey | LBEQBTXAQXRZEG-GXSJLCMTSA-N |
| XLogP | 0.91 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|