C12H15NO4S — CID 154632471
(1-acetylazetidin-3-yl) 4-methylbenzenesulfonate (PubChem CID 154632471) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is (1-acetylazetidin-3-yl) 4-methylbenzenesulfonate.
| Compound Name | (1-acetylazetidin-3-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 154632471 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (1-acetylazetidin-3-yl) 4-methylbenzenesulfonate |
| SMILES | CC(=O)N1CC(OS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C12H15NO4S/c1-9-3-5-12(6-4-9)18(15,16)17-11-7-13(8-11)10(2)14/h3-6,11H,7-8H2,1-2H3 |
| InChIKey | WJCFAVIDYHFVME-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|