C16H20O7S — CID 134880852
trans-dimethyl (1S,2S)-4-(4-methylphenyl)sulfonyloxycyclopentane-1,2-dicarboxylate (PubChem CID 134880852) has the molecular formula C16H20O7S and a molecular weight of 356.40 g/mol. Its IUPAC name is trans-dimethyl (1S,2S)-4-(4-methylphenyl)sulfonyloxycyclopentane-1,2-dicarboxylate.
| Compound Name | trans-dimethyl (1S,2S)-4-(4-methylphenyl)sulfonyloxycyclopentane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134880852 |
| Molecular Formula | C16H20O7S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | trans-dimethyl (1S,2S)-4-(4-methylphenyl)sulfonyloxycyclopentane-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1CC(OS(=O)(=O)c2ccc(C)cc2)C[C@@H]1C(=O)OC |
| InChI | InChI=1S/C16H20O7S/c1-10-4-6-12(7-5-10)24(19,20)23-11-8-13(15(17)21-2)14(9-11)16(18)22-3/h4-7,11,13-14H,8-9H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | MCSZWIOGMJKXNE-KBPBESRZSA-N |
| XLogP | 1.44 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|