C14H14F3NO7S — CID 87450011
(2S,5S)-5-[4-(trifluoromethyl)phenyl]sulfonyloxypiperidine-1,2-dicarboxylic acid (PubChem CID 87450011) has the molecular formula C14H14F3NO7S and a molecular weight of 397.33 g/mol. Its IUPAC name is (2S,5S)-5-[4-(trifluoromethyl)phenyl]sulfonyloxypiperidine-1,2-dicarboxylic acid.
| Compound Name | (2S,5S)-5-[4-(trifluoromethyl)phenyl]sulfonyloxypiperidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 87450011 |
| Molecular Formula | C14H14F3NO7S |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | (2S,5S)-5-[4-(trifluoromethyl)phenyl]sulfonyloxypiperidine-1,2-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1CC[C@H](OS(=O)(=O)c2ccc(C(F)(F)F)cc2)CN1C(=O)O |
| InChI | InChI=1S/C14H14F3NO7S/c15-14(16,17)8-1-4-10(5-2-8)26(23,24)25-9-3-6-11(12(19)20)18(7-9)13(21)22/h1-2,4-5,9,11H,3,6-7H2,(H,19,20)(H,21,22)/t9-,11-/m0/s1 |
| InChIKey | BEIYCAMGEHPHEQ-ONGXEEELSA-N |
| XLogP | 2.01 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|