C17H21F3O5S — CID 86762206
ethyl 2-[4-[4-(trifluoromethyl)phenyl]sulfonyloxycyclohexyl]acetate (PubChem CID 86762206) has the molecular formula C17H21F3O5S and a molecular weight of 394.41 g/mol. Its IUPAC name is ethyl 2-[4-[4-(trifluoromethyl)phenyl]sulfonyloxycyclohexyl]acetate.
| Compound Name | ethyl 2-[4-[4-(trifluoromethyl)phenyl]sulfonyloxycyclohexyl]acetate |
|---|---|
| PubChem CID | 86762206 |
| Molecular Formula | C17H21F3O5S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | ethyl 2-[4-[4-(trifluoromethyl)phenyl]sulfonyloxycyclohexyl]acetate |
| SMILES | CCOC(=O)CC1CCC(OS(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H21F3O5S/c1-2-24-16(21)11-12-3-7-14(8-4-12)25-26(22,23)15-9-5-13(6-10-15)17(18,19)20/h5-6,9-10,12,14H,2-4,7-8,11H2,1H3 |
| InChIKey | JNKYPOIPXJPUMG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|