C18H23F3O5S — CID 88563350
tert-butyl 4-[4-(trifluoromethyl)phenyl]sulfonyloxycyclohexane-1-carboxylate (PubChem CID 88563350) has the molecular formula C18H23F3O5S and a molecular weight of 408.44 g/mol. Its IUPAC name is tert-butyl 4-[4-(trifluoromethyl)phenyl]sulfonyloxycyclohexane-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(trifluoromethyl)phenyl]sulfonyloxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 88563350 |
| Molecular Formula | C18H23F3O5S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | tert-butyl 4-[4-(trifluoromethyl)phenyl]sulfonyloxycyclohexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCC(OS(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H23F3O5S/c1-17(2,3)25-16(22)12-4-8-14(9-5-12)26-27(23,24)15-10-6-13(7-11-15)18(19,20)21/h6-7,10-12,14H,4-5,8-9H2,1-3H3 |
| InChIKey | PGZZAVMPPAZQMG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|