C28H43F3N3O6S+ — CID 91397691
tert-butyl 1-methyl-2-[(1-methylazonan-4-yl)carbamoyl]-5-[4-(trifluoromethyl)phenyl]sulfonyloxypiperidin-1-ium-1-carboxylate (PubChem CID 91397691) has the molecular formula C28H43F3N3O6S+ and a molecular weight of 606.73 g/mol. Its IUPAC name is tert-butyl 1-methyl-2-[(1-methylazonan-4-yl)carbamoyl]-5-[4-(trifluoromethyl)phenyl]sulfonyloxypiperidin-1-ium-1-carboxylate.
| Compound Name | tert-butyl 1-methyl-2-[(1-methylazonan-4-yl)carbamoyl]-5-[4-(trifluoromethyl)phenyl]sulfonyloxypiperidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 91397691 |
| Molecular Formula | C28H43F3N3O6S+ |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | tert-butyl 1-methyl-2-[(1-methylazonan-4-yl)carbamoyl]-5-[4-(trifluoromethyl)phenyl]sulfonyloxypiperidin-1-ium-1-carboxylate |
| SMILES | CN1CCCCCC(NC(=O)C2CCC(OS(=O)(=O)c3ccc(C(F)(F)F)cc3)C[N+]2(C)C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C28H42F3N3O6S/c1-27(2,3)39-26(36)34(5)19-22(40-41(37,38)23-13-10-20(11-14-23)28(29,30)31)12-15-24(34)25(35)32-21-9-7-6-8-17-33(4)18-16-21/h10-11,13-14,21-22,24H,6-9,12,15-19H2,1-5H3/p+1 |
| InChIKey | GRARAPXLXZEITH-UHFFFAOYSA-O |
| XLogP | 4.70 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|