C14H15F3O4S — CID 118119369
[(1R,3S)-3-acetylcyclopentyl] 4-(trifluoromethyl)benzenesulfonate (PubChem CID 118119369) has the molecular formula C14H15F3O4S and a molecular weight of 336.33 g/mol. Its IUPAC name is [(1R,3S)-3-acetylcyclopentyl] 4-(trifluoromethyl)benzenesulfonate.
| Compound Name | [(1R,3S)-3-acetylcyclopentyl] 4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 118119369 |
| Molecular Formula | C14H15F3O4S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | [(1R,3S)-3-acetylcyclopentyl] 4-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(=O)[C@H]1CC[C@@H](OS(=O)(=O)c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C14H15F3O4S/c1-9(18)10-2-5-12(8-10)21-22(19,20)13-6-3-11(4-7-13)14(15,16)17/h3-4,6-7,10,12H,2,5,8H2,1H3/t10-,12+/m0/s1 |
| InChIKey | DIWAFODVJFYVAY-CMPLNLGQSA-N |
| XLogP | 3.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|