C20H18F6O8S2 — CID 90817223
[3-[4-(trifluoromethoxy)phenyl]sulfonyloxycyclohexyl] 4-(trifluoromethoxy)benzenesulfonate (PubChem CID 90817223) has the molecular formula C20H18F6O8S2 and a molecular weight of 564.48 g/mol. Its IUPAC name is [3-[4-(trifluoromethoxy)phenyl]sulfonyloxycyclohexyl] 4-(trifluoromethoxy)benzenesulfonate.
| Compound Name | [3-[4-(trifluoromethoxy)phenyl]sulfonyloxycyclohexyl] 4-(trifluoromethoxy)benzenesulfonate |
|---|---|
| PubChem CID | 90817223 |
| Molecular Formula | C20H18F6O8S2 |
| Molecular Weight | 564.48 g/mol |
| Exact Mass | 564.03 |
| IUPAC Name | [3-[4-(trifluoromethoxy)phenyl]sulfonyloxycyclohexyl] 4-(trifluoromethoxy)benzenesulfonate |
| SMILES | O=S(=O)(OC1CCCC(OS(=O)(=O)c2ccc(OC(F)(F)F)cc2)C1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18F6O8S2/c21-19(22,23)31-13-4-8-17(9-5-13)35(27,28)33-15-2-1-3-16(12-15)34-36(29,30)18-10-6-14(7-11-18)32-20(24,25)26/h4-11,15-16H,1-3,12H2 |
| InChIKey | DEGMKBXZBURPNM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|