About (5-methylcyclooctyl) 4-methylbenzenesulfonate
(5-methylcyclooctyl) 4-methylbenzenesulfonate (PubChem CID 20590587) has the molecular formula C16H24O3S
and a molecular weight of 296.43 g/mol. Its IUPAC name is (5-methylcyclooctyl) 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (5-methylcyclooctyl) 4-methylbenzenesulfonate |
| PubChem CID | 20590587 |
| Molecular Formula | C16H24O3S |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (5-methylcyclooctyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCCC(C)CCC2)cc1 |
| InChI | InChI=1S/C16H24O3S/c1-13-5-3-7-15(8-4-6-13)19-20(17,18)16-11-9-14(2)10-12-16/h9-13,15H,3-8H2,1-2H3 |
| InChIKey | DSRDOTQMLLRNLS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (5-methylcyclooctyl) 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methylcyclooctyl) 4-methylbenzenesulfonate?
The IUPAC name of (5-methylcyclooctyl) 4-methylbenzenesulfonate (CID 20590587) is (5-methylcyclooctyl) 4-methylbenzenesulfonate.
What is the SMILES notation for (5-methylcyclooctyl) 4-methylbenzenesulfonate?
The canonical SMILES for (5-methylcyclooctyl) 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OC2CCCC(C)CCC2)cc1.
What is the InChIKey of (5-methylcyclooctyl) 4-methylbenzenesulfonate?
The InChIKey is DSRDOTQMLLRNLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O3S/c1-13-5-3-7-15(8-4-6-13)19-20(17,18)16-11-9-14(2)10-12-16/h9-13,15H,3-8H2,1-2H3.
What are the key properties of (5-methylcyclooctyl) 4-methylbenzenesulfonate?
(5-methylcyclooctyl) 4-methylbenzenesulfonate has a molecular weight of 296.43 g/mol, XLogP of 4.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methylcyclooctyl) 4-methylbenzenesulfonate is sourced from PubChem (CID 20590587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).