C13H16O3S — CID 101100496
[(1S)-cyclohex-2-en-1-yl] 4-methylbenzenesulfonate (PubChem CID 101100496) has the molecular formula C13H16O3S and a molecular weight of 252.34 g/mol. Its IUPAC name is [(1S)-cyclohex-2-en-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S)-cyclohex-2-en-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101100496 |
| Molecular Formula | C13H16O3S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | [(1S)-cyclohex-2-en-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2C=CCCC2)cc1 |
| InChI | InChI=1S/C13H16O3S/c1-11-7-9-13(10-8-11)17(14,15)16-12-5-3-2-4-6-12/h3,5,7-10,12H,2,4,6H2,1H3/t12-/m1/s1 |
| InChIKey | VHHOWKKRRKPTRO-GFCCVEGCSA-N |
| XLogP | 2.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|