C12H12O4S — CID 12702303
[(1R)-4-oxocyclopent-2-en-1-yl] 4-methylbenzenesulfonate (PubChem CID 12702303) has the molecular formula C12H12O4S and a molecular weight of 252.29 g/mol. Its IUPAC name is [(1R)-4-oxocyclopent-2-en-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1R)-4-oxocyclopent-2-en-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 12702303 |
| Molecular Formula | C12H12O4S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | [(1R)-4-oxocyclopent-2-en-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2C=CC(=O)C2)cc1 |
| InChI | InChI=1S/C12H12O4S/c1-9-2-6-12(7-3-9)17(14,15)16-11-5-4-10(13)8-11/h2-7,11H,8H2,1H3/t11-/m0/s1 |
| InChIKey | LMJQPVQUXLURGH-NSHDSACASA-N |
| XLogP | 1.60 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|