C26H26O6S2 — CID 14063927
[(1R,4S,6R,9S)-12-(4-methylphenyl)sulfonyloxy-5-tetracyclo[7.2.1.04,11.06,10]dodeca-2,7-dienyl] 4-methylbenzenesulfonate (PubChem CID 14063927) has the molecular formula C26H26O6S2 and a molecular weight of 498.62 g/mol. Its IUPAC name is [(1R,4S,6R,9S)-12-(4-methylphenyl)sulfonyloxy-5-tetracyclo[7.2.1.04,11.06,10]dodeca-2,7-dienyl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,4S,6R,9S)-12-(4-methylphenyl)sulfonyloxy-5-tetracyclo[7.2.1.04,11.06,10]dodeca-2,7-dienyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14063927 |
| Molecular Formula | C26H26O6S2 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | [(1R,4S,6R,9S)-12-(4-methylphenyl)sulfonyloxy-5-tetracyclo[7.2.1.04,11.06,10]dodeca-2,7-dienyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2[C@H]3C=C[C@H]4C(OS(=O)(=O)c5ccc(C)cc5)[C@H]5C=C[C@@H]2C5C34)cc1 |
| InChI | InChI=1S/C26H26O6S2/c1-15-3-7-17(8-4-15)33(27,28)31-25-19-11-13-21-23(19)24-20(25)12-14-22(24)26(21)32-34(29,30)18-9-5-16(2)6-10-18/h3-14,19-26H,1-2H3/t19-,20+,21+,22-,23?,24?,25?,26? |
| InChIKey | XZCIFUZDKVXONG-QIKNZOTHSA-N |
| XLogP | 4.02 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|