C18H20O7S2 — CID 13407996
[(3R,4R)-4-(4-methylphenyl)sulfonyloxyoxolan-3-yl] 4-methylbenzenesulfonate (PubChem CID 13407996) has the molecular formula C18H20O7S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is [(3R,4R)-4-(4-methylphenyl)sulfonyloxyoxolan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3R,4R)-4-(4-methylphenyl)sulfonyloxyoxolan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 13407996 |
| Molecular Formula | C18H20O7S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | [(3R,4R)-4-(4-methylphenyl)sulfonyloxyoxolan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2COC[C@H]2OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H20O7S2/c1-13-3-7-15(8-4-13)26(19,20)24-17-11-23-12-18(17)25-27(21,22)16-9-5-14(2)6-10-16/h3-10,17-18H,11-12H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | CGGLMQTYQGBBLC-QZTJIDSGSA-N |
| XLogP | 2.18 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|