C12H15FO4S — CID 118540354
[(3S,4S)-3-fluorooxan-4-yl] 4-methylbenzenesulfonate (PubChem CID 118540354) has the molecular formula C12H15FO4S and a molecular weight of 274.31 g/mol. Its IUPAC name is [(3S,4S)-3-fluorooxan-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3S,4S)-3-fluorooxan-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 118540354 |
| Molecular Formula | C12H15FO4S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | [(3S,4S)-3-fluorooxan-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CCOC[C@@H]2F)cc1 |
| InChI | InChI=1S/C12H15FO4S/c1-9-2-4-10(5-3-9)18(14,15)17-12-6-7-16-8-11(12)13/h2-5,11-12H,6-8H2,1H3/t11-,12-/m0/s1 |
| InChIKey | HVWYPRXRIOFBAE-RYUDHWBXSA-N |
| XLogP | 1.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|