C13H18O4S — CID 162523624
(2-methyloxan-3-yl) 4-methylbenzenesulfonate (PubChem CID 162523624) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is (2-methyloxan-3-yl) 4-methylbenzenesulfonate.
| Compound Name | (2-methyloxan-3-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 162523624 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (2-methyloxan-3-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCCOC2C)cc1 |
| InChI | InChI=1S/C13H18O4S/c1-10-5-7-12(8-6-10)18(14,15)17-13-4-3-9-16-11(13)2/h5-8,11,13H,3-4,9H2,1-2H3 |
| InChIKey | AXSRXGDGWWGORN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|