C13H18O3S — CID 12768473
(2-methylcyclopentyl) 4-methylbenzenesulfonate (PubChem CID 12768473) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is (2-methylcyclopentyl) 4-methylbenzenesulfonate.
| Compound Name | (2-methylcyclopentyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 12768473 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | (2-methylcyclopentyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCCC2C)cc1 |
| InChI | InChI=1S/C13H18O3S/c1-10-6-8-12(9-7-10)17(14,15)16-13-5-3-4-11(13)2/h6-9,11,13H,3-5H2,1-2H3 |
| InChIKey | WHARVEMTFAGNFI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|