C14H20O4S — CID 12700779
[(1S,2S)-2-methoxycyclohexyl] 4-methylbenzenesulfonate (PubChem CID 12700779) has the molecular formula C14H20O4S and a molecular weight of 284.38 g/mol. Its IUPAC name is [(1S,2S)-2-methoxycyclohexyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2S)-2-methoxycyclohexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 12700779 |
| Molecular Formula | C14H20O4S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | [(1S,2S)-2-methoxycyclohexyl] 4-methylbenzenesulfonate |
| SMILES | CO[C@H]1CCCC[C@@H]1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H20O4S/c1-11-7-9-12(10-8-11)19(15,16)18-14-6-4-3-5-13(14)17-2/h7-10,13-14H,3-6H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | MQZZJCOOKYULDO-KBPBESRZSA-N |
| XLogP | 2.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|