C12H15NO6S — CID 150313419
[(1S,2S)-2-methoxycyclopentyl] 4-nitrobenzenesulfonate (PubChem CID 150313419) has the molecular formula C12H15NO6S and a molecular weight of 301.32 g/mol. Its IUPAC name is [(1S,2S)-2-methoxycyclopentyl] 4-nitrobenzenesulfonate.
| Compound Name | [(1S,2S)-2-methoxycyclopentyl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 150313419 |
| Molecular Formula | C12H15NO6S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | [(1S,2S)-2-methoxycyclopentyl] 4-nitrobenzenesulfonate |
| SMILES | CO[C@H]1CCC[C@@H]1OS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H15NO6S/c1-18-11-3-2-4-12(11)19-20(16,17)10-7-5-9(6-8-10)13(14)15/h5-8,11-12H,2-4H2,1H3/t11-,12-/m0/s1 |
| InChIKey | GMCIICTWXCVJHR-RYUDHWBXSA-N |
| XLogP | 1.87 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|