C11H12N4O5S — CID 142667563
[(1R,2S)-2-azidocyclopentyl] 4-nitrobenzenesulfonate (PubChem CID 142667563) has the molecular formula C11H12N4O5S and a molecular weight of 312.31 g/mol. Its IUPAC name is [(1R,2S)-2-azidocyclopentyl] 4-nitrobenzenesulfonate.
| Compound Name | [(1R,2S)-2-azidocyclopentyl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 142667563 |
| Molecular Formula | C11H12N4O5S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | [(1R,2S)-2-azidocyclopentyl] 4-nitrobenzenesulfonate |
| SMILES | [N-]=[N+]=N[C@H]1CCC[C@H]1OS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H12N4O5S/c12-14-13-10-2-1-3-11(10)20-21(18,19)9-6-4-8(5-7-9)15(16)17/h4-7,10-11H,1-3H2/t10-,11+/m0/s1 |
| InChIKey | AEFSVCMAQJIBMG-WDEREUQCSA-N |
| XLogP | 2.53 |
| TPSA | 135.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|