C12H14BrNO5S — CID 23262625
[(1S,2S)-2-bromocyclohexyl] 4-nitrobenzenesulfonate (PubChem CID 23262625) has the molecular formula C12H14BrNO5S and a molecular weight of 364.22 g/mol. Its IUPAC name is [(1S,2S)-2-bromocyclohexyl] 4-nitrobenzenesulfonate.
| Compound Name | [(1S,2S)-2-bromocyclohexyl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 23262625 |
| Molecular Formula | C12H14BrNO5S |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | [(1S,2S)-2-bromocyclohexyl] 4-nitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)O[C@H]2CCCC[C@@H]2Br)cc1 |
| InChI | InChI=1S/C12H14BrNO5S/c13-11-3-1-2-4-12(11)19-20(17,18)10-7-5-9(6-8-10)14(15)16/h5-8,11-12H,1-4H2/t11-,12-/m0/s1 |
| InChIKey | BABVDRDGOKPVDJ-RYUDHWBXSA-N |
| XLogP | 3.01 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|