C14H17NO6S — CID 125468004
[(3aR,4R,7aR)-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran-4-yl] 4-nitrobenzenesulfonate (PubChem CID 125468004) has the molecular formula C14H17NO6S and a molecular weight of 327.36 g/mol. Its IUPAC name is [(3aR,4R,7aR)-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran-4-yl] 4-nitrobenzenesulfonate.
| Compound Name | [(3aR,4R,7aR)-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran-4-yl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 125468004 |
| Molecular Formula | C14H17NO6S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | [(3aR,4R,7aR)-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran-4-yl] 4-nitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)O[C@@H]2CCC[C@H]3COC[C@@H]32)cc1 |
| InChI | InChI=1S/C14H17NO6S/c16-15(17)11-4-6-12(7-5-11)22(18,19)21-14-3-1-2-10-8-20-9-13(10)14/h4-7,10,13-14H,1-3,8-9H2/t10-,13-,14+/m0/s1 |
| InChIKey | PJFHPMBGWDRYFO-LEWSCRJBSA-N |
| XLogP | 2.12 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|