C14H17NO8S — CID 132574848
[(4aS,7R,7aR)-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-yl] 4-nitrobenzenesulfonate (PubChem CID 132574848) has the molecular formula C14H17NO8S and a molecular weight of 359.36 g/mol. Its IUPAC name is [(4aS,7R,7aR)-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-yl] 4-nitrobenzenesulfonate.
| Compound Name | [(4aS,7R,7aR)-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-yl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 132574848 |
| Molecular Formula | C14H17NO8S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | [(4aS,7R,7aR)-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-yl] 4-nitrobenzenesulfonate |
| SMILES | CC1(C)OC[C@@H]2OC[C@@H](OS(=O)(=O)c3ccc([N+](=O)[O-])cc3)[C@@H]2O1 |
| InChI | InChI=1S/C14H17NO8S/c1-14(2)21-8-11-13(22-14)12(7-20-11)23-24(18,19)10-5-3-9(4-6-10)15(16)17/h3-6,11-13H,7-8H2,1-2H3/t11-,12+,13+/m0/s1 |
| InChIKey | ADBGAWOGGRPAMR-YNEHKIRRSA-N |
| XLogP | 1.22 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|