C16H19NO8 — CID 21139888
[(4aR,6R,7R,7aS)-6-methoxy-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-yl] 4-nitrobenzoate (PubChem CID 21139888) has the molecular formula C16H19NO8 and a molecular weight of 353.33 g/mol. Its IUPAC name is [(4aR,6R,7R,7aS)-6-methoxy-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-yl] 4-nitrobenzoate.
| Compound Name | [(4aR,6R,7R,7aS)-6-methoxy-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 21139888 |
| Molecular Formula | C16H19NO8 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | [(4aR,6R,7R,7aS)-6-methoxy-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-yl] 4-nitrobenzoate |
| SMILES | CO[C@@H]1O[C@@H]2COC(C)(C)O[C@@H]2[C@H]1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H19NO8/c1-16(2)22-8-11-12(25-16)13(15(21-3)23-11)24-14(18)9-4-6-10(7-5-9)17(19)20/h4-7,11-13,15H,8H2,1-3H3/t11-,12+,13-,15-/m1/s1 |
| InChIKey | WUVXSEPTWRBAOY-QVHKTLOISA-N |
| XLogP | 1.64 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|