C21H20N2O10 — CID 40805842
[(2R,3R,5S,6R)-6-methoxy-2-methyl-5-(4-nitrobenzoyl)oxyoxan-3-yl] 4-nitrobenzoate (PubChem CID 40805842) has the molecular formula C21H20N2O10 and a molecular weight of 460.40 g/mol. Its IUPAC name is [(2R,3R,5S,6R)-6-methoxy-2-methyl-5-(4-nitrobenzoyl)oxyoxan-3-yl] 4-nitrobenzoate.
| Compound Name | [(2R,3R,5S,6R)-6-methoxy-2-methyl-5-(4-nitrobenzoyl)oxyoxan-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 40805842 |
| Molecular Formula | C21H20N2O10 |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | [(2R,3R,5S,6R)-6-methoxy-2-methyl-5-(4-nitrobenzoyl)oxyoxan-3-yl] 4-nitrobenzoate |
| SMILES | CO[C@@H]1O[C@H](C)[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)C[C@@H]1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H20N2O10/c1-12-17(32-19(24)13-3-7-15(8-4-13)22(26)27)11-18(21(30-2)31-12)33-20(25)14-5-9-16(10-6-14)23(28)29/h3-10,12,17-18,21H,11H2,1-2H3/t12-,17-,18+,21-/m1/s1 |
| InChIKey | OUAHLGOJWOURHZ-ACDDUUFCSA-N |
| XLogP | 3.04 |
| TPSA | 157.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|