C17H22N2O6 — CID 67314288
tert-butyl (3R,4R)-3-methyl-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate (PubChem CID 67314288) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-methyl-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-methyl-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67314288 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | tert-butyl (3R,4R)-3-methyl-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)C[C@@H]1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H22N2O6/c1-11-9-18(16(21)25-17(2,3)4)10-14(11)24-15(20)12-5-7-13(8-6-12)19(22)23/h5-8,11,14H,9-10H2,1-4H3/t11-,14+/m1/s1 |
| InChIKey | NAJIKBRBJBBBLM-RISCZKNCSA-N |
| XLogP | 3.01 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|