C30H36N4O7 — CID 153284279
tert-butyl (3S,4R)-4-[5-methyl-1-(oxan-2-yl)indazol-6-yl]-3-(4-nitrobenzoyl)oxypiperidine-1-carboxylate (PubChem CID 153284279) has the molecular formula C30H36N4O7 and a molecular weight of 564.64 g/mol. Its IUPAC name is tert-butyl (3S,4R)-4-[5-methyl-1-(oxan-2-yl)indazol-6-yl]-3-(4-nitrobenzoyl)oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-4-[5-methyl-1-(oxan-2-yl)indazol-6-yl]-3-(4-nitrobenzoyl)oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 153284279 |
| Molecular Formula | C30H36N4O7 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | tert-butyl (3S,4R)-4-[5-methyl-1-(oxan-2-yl)indazol-6-yl]-3-(4-nitrobenzoyl)oxypiperidine-1-carboxylate |
| SMILES | Cc1cc2cnn(C3CCCCO3)c2cc1[C@H]1CCN(C(=O)OC(C)(C)C)C[C@H]1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H36N4O7/c1-19-15-21-17-31-33(27-7-5-6-14-39-27)25(21)16-24(19)23-12-13-32(29(36)41-30(2,3)4)18-26(23)40-28(35)20-8-10-22(11-9-20)34(37)38/h8-11,15-17,23,26-27H,5-7,12-14,18H2,1-4H3/t23-,26-,27?/m1/s1 |
| InChIKey | OIAPMEKOOGYBLG-UTZIHYNGSA-N |
| XLogP | 5.90 |
| TPSA | 126.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|