C22H30BrN3O3 — CID 154980153
tert-butyl (3S)-3-[[6-bromo-1-(oxan-2-yl)indazol-4-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 154980153) has the molecular formula C22H30BrN3O3 and a molecular weight of 464.40 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[6-bromo-1-(oxan-2-yl)indazol-4-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[6-bromo-1-(oxan-2-yl)indazol-4-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 154980153 |
| Molecular Formula | C22H30BrN3O3 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | tert-butyl (3S)-3-[[6-bromo-1-(oxan-2-yl)indazol-4-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](Cc2cc(Br)cc3c2cnn3C2CCCCO2)C1 |
| InChI | InChI=1S/C22H30BrN3O3/c1-22(2,3)29-21(27)25-8-7-15(14-25)10-16-11-17(23)12-19-18(16)13-24-26(19)20-6-4-5-9-28-20/h11-13,15,20H,4-10,14H2,1-3H3/t15-,20?/m1/s1 |
| InChIKey | LOGYZKZIQJMBJW-IWPPFLRJSA-N |
| XLogP | 5.30 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |