C29H40BrClN4O4 — CID 171613116
tert-butyl (3aR,7aR)-1-[5-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]pentanoyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-6-carboxylate (PubChem CID 171613116) has the molecular formula C29H40BrClN4O4 and a molecular weight of 624.02 g/mol. Its IUPAC name is tert-butyl (3aR,7aR)-1-[5-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]pentanoyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-6-carboxylate.
| Compound Name | tert-butyl (3aR,7aR)-1-[5-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]pentanoyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 171613116 |
| Molecular Formula | C29H40BrClN4O4 |
| Molecular Weight | 624.02 g/mol |
| Exact Mass | 622.19 |
| IUPAC Name | tert-butyl (3aR,7aR)-1-[5-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]pentanoyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2CCN(C(=O)CCCCc3c(Cl)cc4c(cnn4C4CCCCO4)c3Br)[C@H]2C1 |
| InChI | InChI=1S/C29H40BrClN4O4/c1-29(2,3)39-28(37)33-13-11-19-12-14-34(24(19)18-33)25(36)9-5-4-8-20-22(31)16-23-21(27(20)30)17-32-35(23)26-10-6-7-15-38-26/h16-17,19,24,26H,4-15,18H2,1-3H3/t19-,24-,26?/m0/s1 |
| InChIKey | XORZLPVWWZUZRE-MXNUGYDDSA-N |
| XLogP | 6.72 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.02 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|