C28H31BrClN5O4 — CID 171613551
tert-butyl (3R)-3-[4-[2-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate (PubChem CID 171613551) has the molecular formula C28H31BrClN5O4 and a molecular weight of 616.94 g/mol. Its IUPAC name is tert-butyl (3R)-3-[4-[2-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[4-[2-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 171613551 |
| Molecular Formula | C28H31BrClN5O4 |
| Molecular Weight | 616.94 g/mol |
| Exact Mass | 615.12 |
| IUPAC Name | tert-butyl (3R)-3-[4-[2-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](Oc2nccc(C#Cc3c(Cl)cc4c(cnn4C4CCCCO4)c3Br)n2)C1 |
| InChI | InChI=1S/C28H31BrClN5O4/c1-28(2,3)39-27(36)34-13-6-7-19(17-34)38-26-31-12-11-18(33-26)9-10-20-22(30)15-23-21(25(20)29)16-32-35(23)24-8-4-5-14-37-24/h11-12,15-16,19,24H,4-8,13-14,17H2,1-3H3/t19-,24?/m1/s1 |
| InChIKey | VRGUQUYCMGORHU-PHSANKKPSA-N |
| XLogP | 6.12 |
| TPSA | 91.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.94 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|