C28H40BrClN4O5 — CID 171613391
tert-butyl (3R)-3-[3-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]propoxycarbonylamino]-3-methylazepane-1-carboxylate (PubChem CID 171613391) has the molecular formula C28H40BrClN4O5 and a molecular weight of 628.01 g/mol. Its IUPAC name is tert-butyl (3R)-3-[3-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]propoxycarbonylamino]-3-methylazepane-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[3-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]propoxycarbonylamino]-3-methylazepane-1-carboxylate |
|---|---|
| PubChem CID | 171613391 |
| Molecular Formula | C28H40BrClN4O5 |
| Molecular Weight | 628.01 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | tert-butyl (3R)-3-[3-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]propoxycarbonylamino]-3-methylazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@@](C)(NC(=O)OCCCc2c(Cl)cc3c(cnn3C3CCCCO3)c2Br)C1 |
| InChI | InChI=1S/C28H40BrClN4O5/c1-27(2,3)39-26(36)33-13-7-6-12-28(4,18-33)32-25(35)38-15-9-10-19-21(30)16-22-20(24(19)29)17-31-34(22)23-11-5-8-14-37-23/h16-17,23H,5-15,18H2,1-4H3,(H,32,35)/t23?,28-/m1/s1 |
| InChIKey | DEKCSPJMFLYNHH-GBAZGAGXSA-N |
| XLogP | 6.99 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.01 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|