C28H39BrClN3O5 — CID 177285066
tert-butyl (3R)-3-[3-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]propoxycarbonylamino]cycloheptane-1-carboxylate (PubChem CID 177285066) has the molecular formula C28H39BrClN3O5 and a molecular weight of 612.99 g/mol. Its IUPAC name is tert-butyl (3R)-3-[3-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]propoxycarbonylamino]cycloheptane-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[3-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]propoxycarbonylamino]cycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 177285066 |
| Molecular Formula | C28H39BrClN3O5 |
| Molecular Weight | 612.99 g/mol |
| Exact Mass | 611.18 |
| IUPAC Name | tert-butyl (3R)-3-[3-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]propoxycarbonylamino]cycloheptane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCCC[C@@H](NC(=O)OCCCc2c(Cl)cc3c(cnn3C3CCCCO3)c2Br)C1 |
| InChI | InChI=1S/C28H39BrClN3O5/c1-28(2,3)38-26(34)18-9-4-5-10-19(15-18)32-27(35)37-14-8-11-20-22(30)16-23-21(25(20)29)17-31-33(23)24-12-6-7-13-36-24/h16-19,24H,4-15H2,1-3H3,(H,32,35)/t18?,19-,24?/m1/s1 |
| InChIKey | WFFURBBYJLNEPO-IQJRZOLZSA-N |
| XLogP | 7.10 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.99 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|