C16H17BrClN5O2 — CID 171613642
1-azido-4-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]butan-2-one (PubChem CID 171613642) has the molecular formula C16H17BrClN5O2 and a molecular weight of 426.70 g/mol. Its IUPAC name is 1-azido-4-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]butan-2-one.
| Compound Name | 1-azido-4-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]butan-2-one |
|---|---|
| PubChem CID | 171613642 |
| Molecular Formula | C16H17BrClN5O2 |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 1-azido-4-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]butan-2-one |
| SMILES | [N-]=[N+]=NCC(=O)CCc1c(Cl)cc2c(cnn2C2CCCCO2)c1Br |
| InChI | InChI=1S/C16H17BrClN5O2/c17-16-11(5-4-10(24)8-20-22-19)13(18)7-14-12(16)9-21-23(14)15-3-1-2-6-25-15/h7,9,15H,1-6,8H2 |
| InChIKey | QXBGPTVJFIRJBN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 92.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|