C17H18BrClN2O2 — CID 177330332
2-[(1S,2S)-2-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]cyclopropyl]acetaldehyde (PubChem CID 177330332) has the molecular formula C17H18BrClN2O2 and a molecular weight of 397.70 g/mol. Its IUPAC name is 2-[(1S,2S)-2-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]cyclopropyl]acetaldehyde.
| Compound Name | 2-[(1S,2S)-2-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]cyclopropyl]acetaldehyde |
|---|---|
| PubChem CID | 177330332 |
| Molecular Formula | C17H18BrClN2O2 |
| Molecular Weight | 397.70 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 2-[(1S,2S)-2-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]cyclopropyl]acetaldehyde |
| SMILES | O=CC[C@@H]1C[C@@H]1c1c(Cl)cc2c(cnn2C2CCCCO2)c1Br |
| InChI | InChI=1S/C17H18BrClN2O2/c18-17-12-9-20-21(15-3-1-2-6-23-15)14(12)8-13(19)16(17)11-7-10(11)4-5-22/h5,8-11,15H,1-4,6-7H2/t10-,11+,15?/m1/s1 |
| InChIKey | WUCNCJWHNAOYSQ-SPJRPDJQSA-N |
| XLogP | 4.84 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.70 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|