C18H18BrClN2O3 — CID 171613507
methyl (2E,4E)-5-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]penta-2,4-dienoate (PubChem CID 171613507) has the molecular formula C18H18BrClN2O3 and a molecular weight of 425.71 g/mol. Its IUPAC name is methyl (2E,4E)-5-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]penta-2,4-dienoate.
| Compound Name | methyl (2E,4E)-5-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 171613507 |
| Molecular Formula | C18H18BrClN2O3 |
| Molecular Weight | 425.71 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | methyl (2E,4E)-5-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]penta-2,4-dienoate |
| SMILES | COC(=O)/C=C/C=C/c1c(Cl)cc2c(cnn2C2CCCCO2)c1Br |
| InChI | InChI=1S/C18H18BrClN2O3/c1-24-17(23)8-3-2-6-12-14(20)10-15-13(18(12)19)11-21-22(15)16-7-4-5-9-25-16/h2-3,6,8,10-11,16H,4-5,7,9H2,1H3/b6-2+,8-3+ |
| InChIKey | MGNUUTCFWCZHJM-YALUOGEHSA-N |
| XLogP | 4.89 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.71 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|